C29H29F2N5O4 — CID 155434271
[(2S,3R)-2-[(2,3-difluorophenyl)-phenylmethyl]-8,11-dioxo-1,7,13-triazatricyclo[7.4.0.03,7]trideca-9,12-dien-10-yl] 4-methylpiperazine-1-carboxylate (PubChem CID 155434271) has the molecular formula C29H29F2N5O4 and a molecular weight of 549.58 g/mol. Its IUPAC name is [(2S,3R)-2-[(2,3-difluorophenyl)-phenylmethyl]-8,11-dioxo-1,7,13-triazatricyclo[7.4.0.03,7]trideca-9,12-dien-10-yl] 4-methylpiperazine-1-carboxylate.
| Compound Name | [(2S,3R)-2-[(2,3-difluorophenyl)-phenylmethyl]-8,11-dioxo-1,7,13-triazatricyclo[7.4.0.03,7]trideca-9,12-dien-10-yl] 4-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 155434271 |
| Molecular Formula | C29H29F2N5O4 |
| Molecular Weight | 549.58 g/mol |
| Exact Mass | 549.22 |
| IUPAC Name | [(2S,3R)-2-[(2,3-difluorophenyl)-phenylmethyl]-8,11-dioxo-1,7,13-triazatricyclo[7.4.0.03,7]trideca-9,12-dien-10-yl] 4-methylpiperazine-1-carboxylate |
| SMILES | CN1CCN(C(=O)Oc2c3n(ncc2=O)[C@@H](C(c2ccccc2)c2cccc(F)c2F)[C@H]2CCCN2C3=O)CC1 |
| InChI | InChI=1S/C29H29F2N5O4/c1-33-13-15-34(16-14-33)29(39)40-27-22(37)17-32-36-25(21-11-6-12-35(21)28(38)26(27)36)23(18-7-3-2-4-8-18)19-9-5-10-20(30)24(19)31/h2-5,7-10,17,21,23,25H,6,11-16H2,1H3/t21-,23?,25-/m1/s1 |
| InChIKey | KRDRHNIGDPXDLA-MOGRSXHUSA-N |
| XLogP | 3.26 |
| TPSA | 87.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.58 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |