C26H23F2N3O6 — CID 155434222
[(2S,3R)-2-[(2,3-difluorophenyl)-phenylmethyl]-8,11-dioxo-1,7,13-triazatricyclo[7.4.0.03,7]trideca-9,12-dien-10-yl]oxymethyl methyl carbonate (PubChem CID 155434222) has the molecular formula C26H23F2N3O6 and a molecular weight of 511.48 g/mol. Its IUPAC name is [(2S,3R)-2-[(2,3-difluorophenyl)-phenylmethyl]-8,11-dioxo-1,7,13-triazatricyclo[7.4.0.03,7]trideca-9,12-dien-10-yl]oxymethyl methyl carbonate.
| Compound Name | [(2S,3R)-2-[(2,3-difluorophenyl)-phenylmethyl]-8,11-dioxo-1,7,13-triazatricyclo[7.4.0.03,7]trideca-9,12-dien-10-yl]oxymethyl methyl carbonate |
|---|---|
| PubChem CID | 155434222 |
| Molecular Formula | C26H23F2N3O6 |
| Molecular Weight | 511.48 g/mol |
| Exact Mass | 511.16 |
| IUPAC Name | [(2S,3R)-2-[(2,3-difluorophenyl)-phenylmethyl]-8,11-dioxo-1,7,13-triazatricyclo[7.4.0.03,7]trideca-9,12-dien-10-yl]oxymethyl methyl carbonate |
| SMILES | COC(=O)OCOc1c2n(ncc1=O)[C@@H](C(c1ccccc1)c1cccc(F)c1F)[C@H]1CCCN1C2=O |
| InChI | InChI=1S/C26H23F2N3O6/c1-35-26(34)37-14-36-24-19(32)13-29-31-22(18-11-6-12-30(18)25(33)23(24)31)20(15-7-3-2-4-8-15)16-9-5-10-17(27)21(16)28/h2-5,7-10,13,18,20,22H,6,11-12,14H2,1H3/t18-,20?,22-/m1/s1 |
| InChIKey | LVRHAAHUWQESPW-HCNFZCTASA-N |
| XLogP | 3.63 |
| TPSA | 99.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.48 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|