C28H26F3N3O7 — CID 155451605
[(2S,3R)-2-[(R)-(2,3-difluorophenyl)-(3-fluorophenyl)methyl]-8,11-dioxo-1,7,13-triazatricyclo[7.4.0.03,7]trideca-9,12-dien-10-yl]oxymethyl 2-methoxyethyl carbonate (PubChem CID 155451605) has the molecular formula C28H26F3N3O7 and a molecular weight of 573.52 g/mol. Its IUPAC name is [(2S,3R)-2-[(R)-(2,3-difluorophenyl)-(3-fluorophenyl)methyl]-8,11-dioxo-1,7,13-triazatricyclo[7.4.0.03,7]trideca-9,12-dien-10-yl]oxymethyl 2-methoxyethyl carbonate.
| Compound Name | [(2S,3R)-2-[(R)-(2,3-difluorophenyl)-(3-fluorophenyl)methyl]-8,11-dioxo-1,7,13-triazatricyclo[7.4.0.03,7]trideca-9,12-dien-10-yl]oxymethyl 2-methoxyethyl carbonate |
|---|---|
| PubChem CID | 155451605 |
| Molecular Formula | C28H26F3N3O7 |
| Molecular Weight | 573.52 g/mol |
| Exact Mass | 573.17 |
| IUPAC Name | [(2S,3R)-2-[(R)-(2,3-difluorophenyl)-(3-fluorophenyl)methyl]-8,11-dioxo-1,7,13-triazatricyclo[7.4.0.03,7]trideca-9,12-dien-10-yl]oxymethyl 2-methoxyethyl carbonate |
| SMILES | COCCOC(=O)OCOc1c2n(ncc1=O)[C@@H]([C@H](c1cccc(F)c1)c1cccc(F)c1F)[C@H]1CCCN1C2=O |
| InChI | InChI=1S/C28H26F3N3O7/c1-38-11-12-39-28(37)41-15-40-26-21(35)14-32-34-24(20-9-4-10-33(20)27(36)25(26)34)22(16-5-2-6-17(29)13-16)18-7-3-8-19(30)23(18)31/h2-3,5-8,13-14,20,22,24H,4,9-12,15H2,1H3/t20-,22-,24-/m1/s1 |
| InChIKey | CCPPXXAQBMQXQI-KIFXHHALSA-N |
| XLogP | 3.79 |
| TPSA | 109.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.52 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|