C28H27F2N3O5 — CID 155434154
[(2S,3R)-2-[(2,3-difluorophenyl)-phenylmethyl]-8,11-dioxo-1,7,13-triazatricyclo[7.4.0.03,7]trideca-9,12-dien-10-yl] 2-methoxy-2-methylpropanoate (PubChem CID 155434154) has the molecular formula C28H27F2N3O5 and a molecular weight of 523.54 g/mol. Its IUPAC name is [(2S,3R)-2-[(2,3-difluorophenyl)-phenylmethyl]-8,11-dioxo-1,7,13-triazatricyclo[7.4.0.03,7]trideca-9,12-dien-10-yl] 2-methoxy-2-methylpropanoate.
| Compound Name | [(2S,3R)-2-[(2,3-difluorophenyl)-phenylmethyl]-8,11-dioxo-1,7,13-triazatricyclo[7.4.0.03,7]trideca-9,12-dien-10-yl] 2-methoxy-2-methylpropanoate |
|---|---|
| PubChem CID | 155434154 |
| Molecular Formula | C28H27F2N3O5 |
| Molecular Weight | 523.54 g/mol |
| Exact Mass | 523.19 |
| IUPAC Name | [(2S,3R)-2-[(2,3-difluorophenyl)-phenylmethyl]-8,11-dioxo-1,7,13-triazatricyclo[7.4.0.03,7]trideca-9,12-dien-10-yl] 2-methoxy-2-methylpropanoate |
| SMILES | COC(C)(C)C(=O)Oc1c2n(ncc1=O)[C@@H](C(c1ccccc1)c1cccc(F)c1F)[C@H]1CCCN1C2=O |
| InChI | InChI=1S/C28H27F2N3O5/c1-28(2,37-3)27(36)38-25-20(34)15-31-33-23(19-13-8-14-32(19)26(35)24(25)33)21(16-9-5-4-6-10-16)17-11-7-12-18(29)22(17)30/h4-7,9-12,15,19,21,23H,8,13-14H2,1-3H3/t19-,21?,23-/m1/s1 |
| InChIKey | FCQSUUUWFKGGAK-DICHZYRTSA-N |
| XLogP | 3.84 |
| TPSA | 90.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.54 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |