C28H28F2N3O8P — CID 134282194
methyl 2-[[(2S,3R)-2-[bis(4-fluorophenyl)methyl]-8,11-dioxo-1,7,13-triazatricyclo[7.4.0.03,7]trideca-9,12-dien-10-yl]oxy-ethoxyphosphoryl]oxyacetate (PubChem CID 134282194) has the molecular formula C28H28F2N3O8P and a molecular weight of 603.51 g/mol. Its IUPAC name is methyl 2-[[(2S,3R)-2-[bis(4-fluorophenyl)methyl]-8,11-dioxo-1,7,13-triazatricyclo[7.4.0.03,7]trideca-9,12-dien-10-yl]oxy-ethoxyphosphoryl]oxyacetate.
| Compound Name | methyl 2-[[(2S,3R)-2-[bis(4-fluorophenyl)methyl]-8,11-dioxo-1,7,13-triazatricyclo[7.4.0.03,7]trideca-9,12-dien-10-yl]oxy-ethoxyphosphoryl]oxyacetate |
|---|---|
| PubChem CID | 134282194 |
| Molecular Formula | C28H28F2N3O8P |
| Molecular Weight | 603.51 g/mol |
| Exact Mass | 603.16 |
| IUPAC Name | methyl 2-[[(2S,3R)-2-[bis(4-fluorophenyl)methyl]-8,11-dioxo-1,7,13-triazatricyclo[7.4.0.03,7]trideca-9,12-dien-10-yl]oxy-ethoxyphosphoryl]oxyacetate |
| SMILES | CCOP(=O)(OCC(=O)OC)Oc1c2n(ncc1=O)[C@@H](C(c1ccc(F)cc1)c1ccc(F)cc1)[C@H]1CCCN1C2=O |
| InChI | InChI=1S/C28H28F2N3O8P/c1-3-39-42(37,40-16-23(35)38-2)41-27-22(34)15-31-33-25(21-5-4-14-32(21)28(36)26(27)33)24(17-6-10-19(29)11-7-17)18-8-12-20(30)13-9-18/h6-13,15,21,24-25H,3-5,14,16H2,1-2H3/t21-,25-,42?/m1/s1 |
| InChIKey | HFRJHZUVOKAPJC-ZPGXTOMRSA-N |
| XLogP | 4.23 |
| TPSA | 126.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.51 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|