C19H19BClN3OS — CID 159753002
2-(5-chlorothiophen-2-yl)-5-ethyl-6-methyl-N-(2-methyl-3H-1,2-benzoxaborol-6-yl)pyrimidin-4-amine (PubChem CID 159753002) has the molecular formula C19H19BClN3OS and a molecular weight of 383.71 g/mol. Its IUPAC name is 2-(5-chlorothiophen-2-yl)-5-ethyl-6-methyl-N-(2-methyl-3H-1,2-benzoxaborol-6-yl)pyrimidin-4-amine.
| Compound Name | 2-(5-chlorothiophen-2-yl)-5-ethyl-6-methyl-N-(2-methyl-3H-1,2-benzoxaborol-6-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 159753002 |
| Molecular Formula | C19H19BClN3OS |
| Molecular Weight | 383.71 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | 2-(5-chlorothiophen-2-yl)-5-ethyl-6-methyl-N-(2-methyl-3H-1,2-benzoxaborol-6-yl)pyrimidin-4-amine |
| SMILES | CCc1c(C)nc(-c2ccc(Cl)s2)nc1Nc1ccc2c(c1)OB(C)C2 |
| InChI | InChI=1S/C19H19BClN3OS/c1-4-14-11(2)22-19(16-7-8-17(21)26-16)24-18(14)23-13-6-5-12-10-20(3)25-15(12)9-13/h5-9H,4,10H2,1-3H3,(H,22,23,24) |
| InChIKey | OZZFDIRUMYTGPM-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.71 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|