C21H21N3O3S — CID 58775497
2-[4-[[2-(5-acetylthiophen-2-yl)-5-ethyl-6-methylpyrimidin-4-yl]amino]phenyl]acetic acid (PubChem CID 58775497) has the molecular formula C21H21N3O3S and a molecular weight of 395.48 g/mol. Its IUPAC name is 2-[4-[[2-(5-acetylthiophen-2-yl)-5-ethyl-6-methylpyrimidin-4-yl]amino]phenyl]acetic acid.
| Compound Name | 2-[4-[[2-(5-acetylthiophen-2-yl)-5-ethyl-6-methylpyrimidin-4-yl]amino]phenyl]acetic acid |
|---|---|
| PubChem CID | 58775497 |
| Molecular Formula | C21H21N3O3S |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | 2-[4-[[2-(5-acetylthiophen-2-yl)-5-ethyl-6-methylpyrimidin-4-yl]amino]phenyl]acetic acid |
| SMILES | CCc1c(C)nc(-c2ccc(C(C)=O)s2)nc1Nc1ccc(CC(=O)O)cc1 |
| InChI | InChI=1S/C21H21N3O3S/c1-4-16-12(2)22-21(18-10-9-17(28-18)13(3)25)24-20(16)23-15-7-5-14(6-8-15)11-19(26)27/h5-10H,4,11H2,1-3H3,(H,26,27)(H,22,23,24) |
| InChIKey | AWVIBBLNGNSEEI-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |