C21H23N3O2S — CID 58775424
2-[4-[[5-ethyl-2-(4-ethylthiophen-2-yl)-6-methylpyrimidin-4-yl]amino]phenyl]acetic acid (PubChem CID 58775424) has the molecular formula C21H23N3O2S and a molecular weight of 381.50 g/mol. Its IUPAC name is 2-[4-[[5-ethyl-2-(4-ethylthiophen-2-yl)-6-methylpyrimidin-4-yl]amino]phenyl]acetic acid.
| Compound Name | 2-[4-[[5-ethyl-2-(4-ethylthiophen-2-yl)-6-methylpyrimidin-4-yl]amino]phenyl]acetic acid |
|---|---|
| PubChem CID | 58775424 |
| Molecular Formula | C21H23N3O2S |
| Molecular Weight | 381.50 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | 2-[4-[[5-ethyl-2-(4-ethylthiophen-2-yl)-6-methylpyrimidin-4-yl]amino]phenyl]acetic acid |
| SMILES | CCc1csc(-c2nc(C)c(CC)c(Nc3ccc(CC(=O)O)cc3)n2)c1 |
| InChI | InChI=1S/C21H23N3O2S/c1-4-14-10-18(27-12-14)21-22-13(3)17(5-2)20(24-21)23-16-8-6-15(7-9-16)11-19(25)26/h6-10,12H,4-5,11H2,1-3H3,(H,25,26)(H,22,23,24) |
| InChIKey | MRQFYBJFIUMMAT-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.50 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |