C23H27N3O3S — CID 58775097
2-[4-[[5-ethyl-2-[5-(3-methoxypropyl)thiophen-2-yl]-6-methylpyrimidin-4-yl]amino]phenyl]acetic acid (PubChem CID 58775097) has the molecular formula C23H27N3O3S and a molecular weight of 425.55 g/mol. Its IUPAC name is 2-[4-[[5-ethyl-2-[5-(3-methoxypropyl)thiophen-2-yl]-6-methylpyrimidin-4-yl]amino]phenyl]acetic acid.
| Compound Name | 2-[4-[[5-ethyl-2-[5-(3-methoxypropyl)thiophen-2-yl]-6-methylpyrimidin-4-yl]amino]phenyl]acetic acid |
|---|---|
| PubChem CID | 58775097 |
| Molecular Formula | C23H27N3O3S |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | 2-[4-[[5-ethyl-2-[5-(3-methoxypropyl)thiophen-2-yl]-6-methylpyrimidin-4-yl]amino]phenyl]acetic acid |
| SMILES | CCc1c(C)nc(-c2ccc(CCCOC)s2)nc1Nc1ccc(CC(=O)O)cc1 |
| InChI | InChI=1S/C23H27N3O3S/c1-4-19-15(2)24-23(20-12-11-18(30-20)6-5-13-29-3)26-22(19)25-17-9-7-16(8-10-17)14-21(27)28/h7-12H,4-6,13-14H2,1-3H3,(H,27,28)(H,24,25,26) |
| InChIKey | AIWKJAPAGSULCX-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|