C22H23N3O2S — CID 58774889
2-[4-[[2-(4,5-dimethylthiophen-2-yl)-6-methyl-5-prop-2-enylpyrimidin-4-yl]amino]phenyl]acetic acid (PubChem CID 58774889) has the molecular formula C22H23N3O2S and a molecular weight of 393.51 g/mol. Its IUPAC name is 2-[4-[[2-(4,5-dimethylthiophen-2-yl)-6-methyl-5-prop-2-enylpyrimidin-4-yl]amino]phenyl]acetic acid.
| Compound Name | 2-[4-[[2-(4,5-dimethylthiophen-2-yl)-6-methyl-5-prop-2-enylpyrimidin-4-yl]amino]phenyl]acetic acid |
|---|---|
| PubChem CID | 58774889 |
| Molecular Formula | C22H23N3O2S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | 2-[4-[[2-(4,5-dimethylthiophen-2-yl)-6-methyl-5-prop-2-enylpyrimidin-4-yl]amino]phenyl]acetic acid |
| SMILES | C=CCc1c(C)nc(-c2cc(C)c(C)s2)nc1Nc1ccc(CC(=O)O)cc1 |
| InChI | InChI=1S/C22H23N3O2S/c1-5-6-18-14(3)23-22(19-11-13(2)15(4)28-19)25-21(18)24-17-9-7-16(8-10-17)12-20(26)27/h5,7-11H,1,6,12H2,2-4H3,(H,26,27)(H,23,24,25) |
| InChIKey | JYLFEQCVQWVRJC-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|