C27H25N3O4S — CID 58775422
2-[4-[[2-[5-(4-methoxyphenoxy)thiophen-2-yl]-6-methyl-5-prop-2-enylpyrimidin-4-yl]amino]phenyl]acetic acid (PubChem CID 58775422) has the molecular formula C27H25N3O4S and a molecular weight of 487.58 g/mol. Its IUPAC name is 2-[4-[[2-[5-(4-methoxyphenoxy)thiophen-2-yl]-6-methyl-5-prop-2-enylpyrimidin-4-yl]amino]phenyl]acetic acid.
| Compound Name | 2-[4-[[2-[5-(4-methoxyphenoxy)thiophen-2-yl]-6-methyl-5-prop-2-enylpyrimidin-4-yl]amino]phenyl]acetic acid |
|---|---|
| PubChem CID | 58775422 |
| Molecular Formula | C27H25N3O4S |
| Molecular Weight | 487.58 g/mol |
| Exact Mass | 487.16 |
| IUPAC Name | 2-[4-[[2-[5-(4-methoxyphenoxy)thiophen-2-yl]-6-methyl-5-prop-2-enylpyrimidin-4-yl]amino]phenyl]acetic acid |
| SMILES | C=CCc1c(C)nc(-c2ccc(Oc3ccc(OC)cc3)s2)nc1Nc1ccc(CC(=O)O)cc1 |
| InChI | InChI=1S/C27H25N3O4S/c1-4-5-22-17(2)28-27(30-26(22)29-19-8-6-18(7-9-19)16-24(31)32)23-14-15-25(35-23)34-21-12-10-20(33-3)11-13-21/h4,6-15H,1,5,16H2,2-3H3,(H,31,32)(H,28,29,30) |
| InChIKey | TXGKZAPEJIGLEG-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 93.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.58 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|