C22H21N3O2S — CID 58775491
4-[[6-methyl-5-prop-2-enyl-2-[5-[(Z)-prop-1-enyl]thiophen-2-yl]pyrimidin-4-yl]amino]benzoic acid (PubChem CID 58775491) has the molecular formula C22H21N3O2S and a molecular weight of 391.50 g/mol. Its IUPAC name is 4-[[6-methyl-5-prop-2-enyl-2-[5-[(Z)-prop-1-enyl]thiophen-2-yl]pyrimidin-4-yl]amino]benzoic acid.
| Compound Name | 4-[[6-methyl-5-prop-2-enyl-2-[5-[(Z)-prop-1-enyl]thiophen-2-yl]pyrimidin-4-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 58775491 |
| Molecular Formula | C22H21N3O2S |
| Molecular Weight | 391.50 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | 4-[[6-methyl-5-prop-2-enyl-2-[5-[(Z)-prop-1-enyl]thiophen-2-yl]pyrimidin-4-yl]amino]benzoic acid |
| SMILES | C=CCc1c(C)nc(-c2ccc(/C=C\C)s2)nc1Nc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C22H21N3O2S/c1-4-6-17-12-13-19(28-17)21-23-14(3)18(7-5-2)20(25-21)24-16-10-8-15(9-11-16)22(26)27/h4-6,8-13H,2,7H2,1,3H3,(H,26,27)(H,23,24,25)/b6-4- |
| InChIKey | PJEROJKHOKEXSZ-XQRVVYSFSA-N |
| XLogP | 5.72 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.50 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|