C23H25N3O2S — CID 58775343
4-[[6-ethyl-5-prop-2-enyl-2-(5-propylthiophen-2-yl)pyrimidin-4-yl]amino]benzoic acid (PubChem CID 58775343) has the molecular formula C23H25N3O2S and a molecular weight of 407.54 g/mol. Its IUPAC name is 4-[[6-ethyl-5-prop-2-enyl-2-(5-propylthiophen-2-yl)pyrimidin-4-yl]amino]benzoic acid.
| Compound Name | 4-[[6-ethyl-5-prop-2-enyl-2-(5-propylthiophen-2-yl)pyrimidin-4-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 58775343 |
| Molecular Formula | C23H25N3O2S |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | 4-[[6-ethyl-5-prop-2-enyl-2-(5-propylthiophen-2-yl)pyrimidin-4-yl]amino]benzoic acid |
| SMILES | C=CCc1c(CC)nc(-c2ccc(CCC)s2)nc1Nc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C23H25N3O2S/c1-4-7-17-13-14-20(29-17)22-25-19(6-3)18(8-5-2)21(26-22)24-16-11-9-15(10-12-16)23(27)28/h5,9-14H,2,4,6-8H2,1,3H3,(H,27,28)(H,24,25,26) |
| InChIKey | VOXPTPXAQJDASA-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|