C25H27N3O2S — CID 58775292
4-[[6-ethyl-2-[4-[(E)-pent-1-enyl]thiophen-2-yl]-5-prop-2-enylpyrimidin-4-yl]amino]benzoic acid (PubChem CID 58775292) has the molecular formula C25H27N3O2S and a molecular weight of 433.58 g/mol. Its IUPAC name is 4-[[6-ethyl-2-[4-[(E)-pent-1-enyl]thiophen-2-yl]-5-prop-2-enylpyrimidin-4-yl]amino]benzoic acid.
| Compound Name | 4-[[6-ethyl-2-[4-[(E)-pent-1-enyl]thiophen-2-yl]-5-prop-2-enylpyrimidin-4-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 58775292 |
| Molecular Formula | C25H27N3O2S |
| Molecular Weight | 433.58 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | 4-[[6-ethyl-2-[4-[(E)-pent-1-enyl]thiophen-2-yl]-5-prop-2-enylpyrimidin-4-yl]amino]benzoic acid |
| SMILES | C=CCc1c(CC)nc(-c2cc(/C=C/CCC)cs2)nc1Nc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C25H27N3O2S/c1-4-7-8-10-17-15-22(31-16-17)24-27-21(6-3)20(9-5-2)23(28-24)26-19-13-11-18(12-14-19)25(29)30/h5,8,10-16H,2,4,6-7,9H2,1,3H3,(H,29,30)(H,26,27,28)/b10-8+ |
| InChIKey | NFUWNOXGMDSFLR-CSKARUKUSA-N |
| XLogP | 6.75 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.58 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|