C26H25N3O2S — CID 58775395
6-[[6-ethyl-2-(5-ethylthiophen-2-yl)-5-prop-2-enylpyrimidin-4-yl]amino]naphthalene-2-carboxylic acid (PubChem CID 58775395) has the molecular formula C26H25N3O2S and a molecular weight of 443.57 g/mol. Its IUPAC name is 6-[[6-ethyl-2-(5-ethylthiophen-2-yl)-5-prop-2-enylpyrimidin-4-yl]amino]naphthalene-2-carboxylic acid.
| Compound Name | 6-[[6-ethyl-2-(5-ethylthiophen-2-yl)-5-prop-2-enylpyrimidin-4-yl]amino]naphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 58775395 |
| Molecular Formula | C26H25N3O2S |
| Molecular Weight | 443.57 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | 6-[[6-ethyl-2-(5-ethylthiophen-2-yl)-5-prop-2-enylpyrimidin-4-yl]amino]naphthalene-2-carboxylic acid |
| SMILES | C=CCc1c(CC)nc(-c2ccc(CC)s2)nc1Nc1ccc2cc(C(=O)O)ccc2c1 |
| InChI | InChI=1S/C26H25N3O2S/c1-4-7-21-22(6-3)28-25(23-13-12-20(5-2)32-23)29-24(21)27-19-11-10-16-14-18(26(30)31)9-8-17(16)15-19/h4,8-15H,1,5-7H2,2-3H3,(H,30,31)(H,27,28,29) |
| InChIKey | NILZKSVYMKGSHD-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.57 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|