C29H27N3O3S — CID 58775299
4-[[6-ethyl-2-[5-[(E)-2-(4-methoxyphenyl)ethenyl]thiophen-2-yl]-5-prop-2-enylpyrimidin-4-yl]amino]benzoic acid (PubChem CID 58775299) has the molecular formula C29H27N3O3S and a molecular weight of 497.62 g/mol. Its IUPAC name is 4-[[6-ethyl-2-[5-[(E)-2-(4-methoxyphenyl)ethenyl]thiophen-2-yl]-5-prop-2-enylpyrimidin-4-yl]amino]benzoic acid.
| Compound Name | 4-[[6-ethyl-2-[5-[(E)-2-(4-methoxyphenyl)ethenyl]thiophen-2-yl]-5-prop-2-enylpyrimidin-4-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 58775299 |
| Molecular Formula | C29H27N3O3S |
| Molecular Weight | 497.62 g/mol |
| Exact Mass | 497.18 |
| IUPAC Name | 4-[[6-ethyl-2-[5-[(E)-2-(4-methoxyphenyl)ethenyl]thiophen-2-yl]-5-prop-2-enylpyrimidin-4-yl]amino]benzoic acid |
| SMILES | C=CCc1c(CC)nc(-c2ccc(/C=C/c3ccc(OC)cc3)s2)nc1Nc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C29H27N3O3S/c1-4-6-24-25(5-2)31-28(32-27(24)30-21-12-10-20(11-13-21)29(33)34)26-18-17-23(36-26)16-9-19-7-14-22(35-3)15-8-19/h4,7-18H,1,5-6H2,2-3H3,(H,33,34)(H,30,31,32)/b16-9+ |
| InChIKey | DLKIGZKWNCDXNR-CXUHLZMHSA-N |
| XLogP | 7.12 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.62 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|