C24H25N3O2S — CID 58774873
4-[[6-methyl-2-[5-[(E)-pent-1-enyl]thiophen-2-yl]-5-prop-2-enylpyrimidin-4-yl]amino]benzoic acid (PubChem CID 58774873) has the molecular formula C24H25N3O2S and a molecular weight of 419.55 g/mol. Its IUPAC name is 4-[[6-methyl-2-[5-[(E)-pent-1-enyl]thiophen-2-yl]-5-prop-2-enylpyrimidin-4-yl]amino]benzoic acid.
| Compound Name | 4-[[6-methyl-2-[5-[(E)-pent-1-enyl]thiophen-2-yl]-5-prop-2-enylpyrimidin-4-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 58774873 |
| Molecular Formula | C24H25N3O2S |
| Molecular Weight | 419.55 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | 4-[[6-methyl-2-[5-[(E)-pent-1-enyl]thiophen-2-yl]-5-prop-2-enylpyrimidin-4-yl]amino]benzoic acid |
| SMILES | C=CCc1c(C)nc(-c2ccc(/C=C/CCC)s2)nc1Nc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C24H25N3O2S/c1-4-6-7-9-19-14-15-21(30-19)23-25-16(3)20(8-5-2)22(27-23)26-18-12-10-17(11-13-18)24(28)29/h5,7,9-15H,2,4,6,8H2,1,3H3,(H,28,29)(H,25,26,27)/b9-7+ |
| InChIKey | KMXXUAVEQCNUFN-VQHVLOKHSA-N |
| XLogP | 6.50 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.55 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|