C27H25N3O3S — CID 143331766
4-[5-[4,5-diethyl-6-[4-(2-oxoethyl)anilino]pyrimidin-2-yl]thiophen-2-yl]benzoic acid (PubChem CID 143331766) has the molecular formula C27H25N3O3S and a molecular weight of 471.58 g/mol. Its IUPAC name is 4-[5-[4,5-diethyl-6-[4-(2-oxoethyl)anilino]pyrimidin-2-yl]thiophen-2-yl]benzoic acid.
| Compound Name | 4-[5-[4,5-diethyl-6-[4-(2-oxoethyl)anilino]pyrimidin-2-yl]thiophen-2-yl]benzoic acid |
|---|---|
| PubChem CID | 143331766 |
| Molecular Formula | C27H25N3O3S |
| Molecular Weight | 471.58 g/mol |
| Exact Mass | 471.16 |
| IUPAC Name | 4-[5-[4,5-diethyl-6-[4-(2-oxoethyl)anilino]pyrimidin-2-yl]thiophen-2-yl]benzoic acid |
| SMILES | CCc1nc(-c2ccc(-c3ccc(C(=O)O)cc3)s2)nc(Nc2ccc(CC=O)cc2)c1CC |
| InChI | InChI=1S/C27H25N3O3S/c1-3-21-22(4-2)29-26(30-25(21)28-20-11-5-17(6-12-20)15-16-31)24-14-13-23(34-24)18-7-9-19(10-8-18)27(32)33/h5-14,16H,3-4,15H2,1-2H3,(H,32,33)(H,28,29,30) |
| InChIKey | COCDXMWARXLCPK-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.58 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|