C27H29N3O4S — CID 143331746
4-[[5,6-diethyl-2-[5-[(3Z,5E)-5-methoxyhepta-1,3,5-trien-2-yl]oxythiophen-2-yl]pyrimidin-4-yl]amino]benzoic acid (PubChem CID 143331746) has the molecular formula C27H29N3O4S and a molecular weight of 491.61 g/mol. Its IUPAC name is 4-[[5,6-diethyl-2-[5-[(3Z,5E)-5-methoxyhepta-1,3,5-trien-2-yl]oxythiophen-2-yl]pyrimidin-4-yl]amino]benzoic acid.
| Compound Name | 4-[[5,6-diethyl-2-[5-[(3Z,5E)-5-methoxyhepta-1,3,5-trien-2-yl]oxythiophen-2-yl]pyrimidin-4-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 143331746 |
| Molecular Formula | C27H29N3O4S |
| Molecular Weight | 491.61 g/mol |
| Exact Mass | 491.19 |
| IUPAC Name | 4-[[5,6-diethyl-2-[5-[(3Z,5E)-5-methoxyhepta-1,3,5-trien-2-yl]oxythiophen-2-yl]pyrimidin-4-yl]amino]benzoic acid |
| SMILES | C=C(/C=C\C(=C/C)OC)Oc1ccc(-c2nc(CC)c(CC)c(Nc3ccc(C(=O)O)cc3)n2)s1 |
| InChI | InChI=1S/C27H29N3O4S/c1-6-20(33-5)14-9-17(4)34-24-16-15-23(35-24)26-29-22(8-3)21(7-2)25(30-26)28-19-12-10-18(11-13-19)27(31)32/h6,9-16H,4,7-8H2,1-3,5H3,(H,31,32)(H,28,29,30)/b14-9-,20-6+ |
| InChIKey | CEVOBOMHCNJBFK-IYDXNWEYSA-N |
| XLogP | 6.77 |
| TPSA | 93.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.61 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|