C20H17ClFN3O2S — CID 143331524
3-chloro-4-[[6-ethyl-2-(5-fluorothiophen-2-yl)-5-prop-2-enylpyrimidin-4-yl]amino]benzoic acid (PubChem CID 143331524) has the molecular formula C20H17ClFN3O2S and a molecular weight of 417.89 g/mol. Its IUPAC name is 3-chloro-4-[[6-ethyl-2-(5-fluorothiophen-2-yl)-5-prop-2-enylpyrimidin-4-yl]amino]benzoic acid.
| Compound Name | 3-chloro-4-[[6-ethyl-2-(5-fluorothiophen-2-yl)-5-prop-2-enylpyrimidin-4-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 143331524 |
| Molecular Formula | C20H17ClFN3O2S |
| Molecular Weight | 417.89 g/mol |
| Exact Mass | 417.07 |
| IUPAC Name | 3-chloro-4-[[6-ethyl-2-(5-fluorothiophen-2-yl)-5-prop-2-enylpyrimidin-4-yl]amino]benzoic acid |
| SMILES | C=CCc1c(CC)nc(-c2ccc(F)s2)nc1Nc1ccc(C(=O)O)cc1Cl |
| InChI | InChI=1S/C20H17ClFN3O2S/c1-3-5-12-14(4-2)23-19(16-8-9-17(22)28-16)25-18(12)24-15-7-6-11(20(26)27)10-13(15)21/h3,6-10H,1,4-5H2,2H3,(H,26,27)(H,23,24,25) |
| InChIKey | CNADFPWFQWSTNY-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.89 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|