C22H23N3O4S — CID 58775405
4-[[6-ethyl-2-(5-methoxythiophen-3-yl)-5-prop-2-enylpyrimidin-4-yl]amino]-3-methoxybenzoic acid (PubChem CID 58775405) has the molecular formula C22H23N3O4S and a molecular weight of 425.51 g/mol. Its IUPAC name is 4-[[6-ethyl-2-(5-methoxythiophen-3-yl)-5-prop-2-enylpyrimidin-4-yl]amino]-3-methoxybenzoic acid.
| Compound Name | 4-[[6-ethyl-2-(5-methoxythiophen-3-yl)-5-prop-2-enylpyrimidin-4-yl]amino]-3-methoxybenzoic acid |
|---|---|
| PubChem CID | 58775405 |
| Molecular Formula | C22H23N3O4S |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | 4-[[6-ethyl-2-(5-methoxythiophen-3-yl)-5-prop-2-enylpyrimidin-4-yl]amino]-3-methoxybenzoic acid |
| SMILES | C=CCc1c(CC)nc(-c2csc(OC)c2)nc1Nc1ccc(C(=O)O)cc1OC |
| InChI | InChI=1S/C22H23N3O4S/c1-5-7-15-16(6-2)23-20(14-11-19(29-4)30-12-14)25-21(15)24-17-9-8-13(22(26)27)10-18(17)28-3/h5,8-12H,1,6-7H2,2-4H3,(H,26,27)(H,23,24,25) |
| InChIKey | RENMTHJXXXLPJF-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 93.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|