C23H25N3O3S — CID 58775209
ethyl 2-[4-[(6-ethyl-5-prop-2-enyl-2-thiophen-3-ylpyrimidin-4-yl)amino]phenyl]-2-hydroxyacetate (PubChem CID 58775209) has the molecular formula C23H25N3O3S and a molecular weight of 423.54 g/mol. Its IUPAC name is ethyl 2-[4-[(6-ethyl-5-prop-2-enyl-2-thiophen-3-ylpyrimidin-4-yl)amino]phenyl]-2-hydroxyacetate.
| Compound Name | ethyl 2-[4-[(6-ethyl-5-prop-2-enyl-2-thiophen-3-ylpyrimidin-4-yl)amino]phenyl]-2-hydroxyacetate |
|---|---|
| PubChem CID | 58775209 |
| Molecular Formula | C23H25N3O3S |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | ethyl 2-[4-[(6-ethyl-5-prop-2-enyl-2-thiophen-3-ylpyrimidin-4-yl)amino]phenyl]-2-hydroxyacetate |
| SMILES | C=CCc1c(CC)nc(-c2ccsc2)nc1Nc1ccc(C(O)C(=O)OCC)cc1 |
| InChI | InChI=1S/C23H25N3O3S/c1-4-7-18-19(5-2)25-21(16-12-13-30-14-16)26-22(18)24-17-10-8-15(9-11-17)20(27)23(28)29-6-3/h4,8-14,20,27H,1,5-7H2,2-3H3,(H,24,25,26) |
| InChIKey | CBHPVRUBZXDLKE-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|