C23H23N3O2 — CID 54586989
4-[(2-phenyl-6-propan-2-yl-5-prop-2-enylpyrimidin-4-yl)amino]benzoic acid (PubChem CID 54586989) has the molecular formula C23H23N3O2 and a molecular weight of 373.46 g/mol. Its IUPAC name is 4-[(2-phenyl-6-propan-2-yl-5-prop-2-enylpyrimidin-4-yl)amino]benzoic acid.
| Compound Name | 4-[(2-phenyl-6-propan-2-yl-5-prop-2-enylpyrimidin-4-yl)amino]benzoic acid |
|---|---|
| PubChem CID | 54586989 |
| Molecular Formula | C23H23N3O2 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | 4-[(2-phenyl-6-propan-2-yl-5-prop-2-enylpyrimidin-4-yl)amino]benzoic acid |
| SMILES | C=CCc1c(Nc2ccc(C(=O)O)cc2)nc(-c2ccccc2)nc1C(C)C |
| InChI | InChI=1S/C23H23N3O2/c1-4-8-19-20(15(2)3)25-21(16-9-6-5-7-10-16)26-22(19)24-18-13-11-17(12-14-18)23(27)28/h4-7,9-15H,1,8H2,2-3H3,(H,27,28)(H,24,25,26) |
| InChIKey | VCXNFBIOGNEURL-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|