C30H28N4O4 — CID 129051937
(2S)-2-amino-3-[4-[4-[(6-methyl-2-phenyl-5-prop-2-enylpyrimidin-4-yl)amino]benzoyl]oxyphenyl]propanoic acid (PubChem CID 129051937) has the molecular formula C30H28N4O4 and a molecular weight of 508.58 g/mol. Its IUPAC name is (2S)-2-amino-3-[4-[4-[(6-methyl-2-phenyl-5-prop-2-enylpyrimidin-4-yl)amino]benzoyl]oxyphenyl]propanoic acid.
| Compound Name | (2S)-2-amino-3-[4-[4-[(6-methyl-2-phenyl-5-prop-2-enylpyrimidin-4-yl)amino]benzoyl]oxyphenyl]propanoic acid |
|---|---|
| PubChem CID | 129051937 |
| Molecular Formula | C30H28N4O4 |
| Molecular Weight | 508.58 g/mol |
| Exact Mass | 508.21 |
| IUPAC Name | (2S)-2-amino-3-[4-[4-[(6-methyl-2-phenyl-5-prop-2-enylpyrimidin-4-yl)amino]benzoyl]oxyphenyl]propanoic acid |
| SMILES | C=CCc1c(C)nc(-c2ccccc2)nc1Nc1ccc(C(=O)Oc2ccc(C[C@H](N)C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C30H28N4O4/c1-3-7-25-19(2)32-27(21-8-5-4-6-9-21)34-28(25)33-23-14-12-22(13-15-23)30(37)38-24-16-10-20(11-17-24)18-26(31)29(35)36/h3-6,8-17,26H,1,7,18,31H2,2H3,(H,35,36)(H,32,33,34)/t26-/m0/s1 |
| InChIKey | IMCFTPLYJBKBHQ-SANMLTNESA-N |
| XLogP | 5.10 |
| TPSA | 127.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.58 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|