C21H25NO4 — CID 145366936
2-amino-3-[4-(4-tert-butyl-3-methylbenzoyl)oxyphenyl]propanoic acid (PubChem CID 145366936) has the molecular formula C21H25NO4 and a molecular weight of 355.43 g/mol. Its IUPAC name is 2-amino-3-[4-(4-tert-butyl-3-methylbenzoyl)oxyphenyl]propanoic acid.
| Compound Name | 2-amino-3-[4-(4-tert-butyl-3-methylbenzoyl)oxyphenyl]propanoic acid |
|---|---|
| PubChem CID | 145366936 |
| Molecular Formula | C21H25NO4 |
| Molecular Weight | 355.43 g/mol |
| Exact Mass | 355.18 |
| IUPAC Name | 2-amino-3-[4-(4-tert-butyl-3-methylbenzoyl)oxyphenyl]propanoic acid |
| SMILES | Cc1cc(C(=O)Oc2ccc(CC(N)C(=O)O)cc2)ccc1C(C)(C)C |
| InChI | InChI=1S/C21H25NO4/c1-13-11-15(7-10-17(13)21(2,3)4)20(25)26-16-8-5-14(6-9-16)12-18(22)19(23)24/h5-11,18H,12,22H2,1-4H3,(H,23,24) |
| InChIKey | ZKJNPPFVHZFFAJ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.43 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|