C22H23N3O3S — CID 58775311
2-ethoxy-2-[4-[(6-methyl-5-prop-2-enyl-2-thiophen-3-ylpyrimidin-4-yl)amino]phenyl]acetic acid (PubChem CID 58775311) has the molecular formula C22H23N3O3S and a molecular weight of 409.51 g/mol. Its IUPAC name is 2-ethoxy-2-[4-[(6-methyl-5-prop-2-enyl-2-thiophen-3-ylpyrimidin-4-yl)amino]phenyl]acetic acid.
| Compound Name | 2-ethoxy-2-[4-[(6-methyl-5-prop-2-enyl-2-thiophen-3-ylpyrimidin-4-yl)amino]phenyl]acetic acid |
|---|---|
| PubChem CID | 58775311 |
| Molecular Formula | C22H23N3O3S |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | 2-ethoxy-2-[4-[(6-methyl-5-prop-2-enyl-2-thiophen-3-ylpyrimidin-4-yl)amino]phenyl]acetic acid |
| SMILES | C=CCc1c(C)nc(-c2ccsc2)nc1Nc1ccc(C(OCC)C(=O)O)cc1 |
| InChI | InChI=1S/C22H23N3O3S/c1-4-6-18-14(3)23-20(16-11-12-29-13-16)25-21(18)24-17-9-7-15(8-10-17)19(22(26)27)28-5-2/h4,7-13,19H,1,5-6H2,2-3H3,(H,26,27)(H,23,24,25) |
| InChIKey | VSZWVRKXUALBJL-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|