C20H13BrIS- — CID 159754712
CID 159754712 (PubChem CID 159754712) has the molecular formula C20H13BrIS- and a molecular weight of 492.20 g/mol.
| Compound Name | CID 159754712 |
|---|---|
| PubChem CID | 159754712 |
| Molecular Formula | C20H13BrIS- |
| Molecular Weight | 492.20 g/mol |
| Exact Mass | 490.90 |
| IUPAC Name | — |
| SMILES | Brc1cc(-c2ccc([C@H]3C[I-]3)cc2)cc2sc3ccccc3c12 |
| InChI | InChI=1S/C20H13BrIS/c21-16-9-14(12-5-7-13(8-6-12)17-11-22-17)10-19-20(16)15-3-1-2-4-18(15)23-19/h1-10,17H,11H2/q-1/t17-/m1/s1 |
| InChIKey | FCURBLVZCDTRDV-QGZVFWFLSA-N |
| XLogP | 3.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.20 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|