C45H29N3S — CID 168850299
2-phenyl-4-[4-(1-phenyldibenzothiophen-3-yl)phenyl]-6-(4-phenylphenyl)-1,3,5-triazine (PubChem CID 168850299) has the molecular formula C45H29N3S and a molecular weight of 643.82 g/mol. Its IUPAC name is 2-phenyl-4-[4-(1-phenyldibenzothiophen-3-yl)phenyl]-6-(4-phenylphenyl)-1,3,5-triazine.
| Compound Name | 2-phenyl-4-[4-(1-phenyldibenzothiophen-3-yl)phenyl]-6-(4-phenylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 168850299 |
| Molecular Formula | C45H29N3S |
| Molecular Weight | 643.82 g/mol |
| Exact Mass | 643.21 |
| IUPAC Name | 2-phenyl-4-[4-(1-phenyldibenzothiophen-3-yl)phenyl]-6-(4-phenylphenyl)-1,3,5-triazine |
| SMILES | c1ccc(-c2ccc(-c3nc(-c4ccccc4)nc(-c4ccc(-c5cc(-c6ccccc6)c6c(c5)sc5ccccc56)cc4)n3)cc2)cc1 |
| InChI | InChI=1S/C45H29N3S/c1-4-12-30(13-5-1)31-20-24-35(25-21-31)44-46-43(34-16-8-3-9-17-34)47-45(48-44)36-26-22-32(23-27-36)37-28-39(33-14-6-2-7-15-33)42-38-18-10-11-19-40(38)49-41(42)29-37/h1-29H |
| InChIKey | QJSGQGJDXNMOGH-UHFFFAOYSA-N |
| XLogP | 12.24 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.82 |
| LogP ≤ 5 | 12.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |