C41H25N3S — CID 174328600
2-(1-phenanthren-2-yldibenzothiophen-3-yl)-4,6-diphenyl-1,3,5-triazine (PubChem CID 174328600) has the molecular formula C41H25N3S and a molecular weight of 591.74 g/mol. Its IUPAC name is 2-(1-phenanthren-2-yldibenzothiophen-3-yl)-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-(1-phenanthren-2-yldibenzothiophen-3-yl)-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 174328600 |
| Molecular Formula | C41H25N3S |
| Molecular Weight | 591.74 g/mol |
| Exact Mass | 591.18 |
| IUPAC Name | 2-(1-phenanthren-2-yldibenzothiophen-3-yl)-4,6-diphenyl-1,3,5-triazine |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3cc(-c4ccc5c(ccc6ccccc65)c4)c4c(c3)sc3ccccc34)n2)cc1 |
| InChI | InChI=1S/C41H25N3S/c1-3-12-27(13-4-1)39-42-40(28-14-5-2-6-15-28)44-41(43-39)31-24-35(38-34-17-9-10-18-36(34)45-37(38)25-31)30-21-22-33-29(23-30)20-19-26-11-7-8-16-32(26)33/h1-25H |
| InChIKey | LIRYNOFQUSRCRG-UHFFFAOYSA-N |
| XLogP | 11.21 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.74 |
| LogP ≤ 5 | 11.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|