C23H20N2O5 — CID 159756197
2-hydroxy-1-(8-hydroxyquinolin-7-yl)ethanone;2-hydroxy-1-(8-methylquinolin-7-yl)ethanone (PubChem CID 159756197) has the molecular formula C23H20N2O5 and a molecular weight of 404.42 g/mol. Its IUPAC name is 2-hydroxy-1-(8-hydroxyquinolin-7-yl)ethanone;2-hydroxy-1-(8-methylquinolin-7-yl)ethanone.
| Compound Name | 2-hydroxy-1-(8-hydroxyquinolin-7-yl)ethanone;2-hydroxy-1-(8-methylquinolin-7-yl)ethanone |
|---|---|
| PubChem CID | 159756197 |
| Molecular Formula | C23H20N2O5 |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | 2-hydroxy-1-(8-hydroxyquinolin-7-yl)ethanone;2-hydroxy-1-(8-methylquinolin-7-yl)ethanone |
| SMILES | Cc1c(C(=O)CO)ccc2cccnc12.O=C(CO)c1ccc2cccnc2c1O |
| InChI | InChI=1S/C12H11NO2.C11H9NO3/c1-8-10(11(15)7-14)5-4-9-3-2-6-13-12(8)9;13-6-9(14)8-4-3-7-2-1-5-12-10(7)11(8)15/h2-6,14H,7H2,1H3;1-5,13,15H,6H2 |
| InChIKey | NEHIWXNFPAOZGH-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 120.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |