C11H7F9O4 — CID 159756484
2-acetyl-7,7,7-trifluoro-3-oxo-2,6-bis(trifluoromethyl)hept-4-enoic acid (PubChem CID 159756484) has the molecular formula C11H7F9O4 and a molecular weight of 374.16 g/mol. Its IUPAC name is 2-acetyl-7,7,7-trifluoro-3-oxo-2,6-bis(trifluoromethyl)hept-4-enoic acid.
| Compound Name | 2-acetyl-7,7,7-trifluoro-3-oxo-2,6-bis(trifluoromethyl)hept-4-enoic acid |
|---|---|
| PubChem CID | 159756484 |
| Molecular Formula | C11H7F9O4 |
| Molecular Weight | 374.16 g/mol |
| Exact Mass | 374.02 |
| IUPAC Name | 2-acetyl-7,7,7-trifluoro-3-oxo-2,6-bis(trifluoromethyl)hept-4-enoic acid |
| SMILES | CC(=O)C(C(=O)O)(C(=O)C=CC(C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H7F9O4/c1-4(21)8(7(23)24,11(18,19)20)6(22)3-2-5(9(12,13)14)10(15,16)17/h2-3,5H,1H3,(H,23,24) |
| InChIKey | NEIDNUCBLZQSNA-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.16 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|