C10H8F6O4 — CID 158090039
2-acetyl-7,7,7-trifluoro-3-oxo-6-(trifluoromethyl)hept-4-enoic acid (PubChem CID 158090039) has the molecular formula C10H8F6O4 and a molecular weight of 306.16 g/mol. Its IUPAC name is 2-acetyl-7,7,7-trifluoro-3-oxo-6-(trifluoromethyl)hept-4-enoic acid.
| Compound Name | 2-acetyl-7,7,7-trifluoro-3-oxo-6-(trifluoromethyl)hept-4-enoic acid |
|---|---|
| PubChem CID | 158090039 |
| Molecular Formula | C10H8F6O4 |
| Molecular Weight | 306.16 g/mol |
| Exact Mass | 306.03 |
| IUPAC Name | 2-acetyl-7,7,7-trifluoro-3-oxo-6-(trifluoromethyl)hept-4-enoic acid |
| SMILES | CC(=O)C(C(=O)O)C(=O)C=CC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H8F6O4/c1-4(17)7(8(19)20)5(18)2-3-6(9(11,12)13)10(14,15)16/h2-3,6-7H,1H3,(H,19,20) |
| InChIKey | FNZIJNHDYDFWMK-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.16 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|