About 2-bromo-4-methoxyaniline;1-(2-bromo-4-methoxyphenyl)tetrazole
2-bromo-4-methoxyaniline;1-(2-bromo-4-methoxyphenyl)tetrazole (PubChem CID 159756962) has the molecular formula C15H15Br2N5O2
and a molecular weight of 457.13 g/mol. Its IUPAC name is 2-bromo-4-methoxyaniline;1-(2-bromo-4-methoxyphenyl)tetrazole.
Molecular Properties
| Compound Name | 2-bromo-4-methoxyaniline;1-(2-bromo-4-methoxyphenyl)tetrazole |
| PubChem CID | 159756962 |
| Molecular Formula | C15H15Br2N5O2 |
| Molecular Weight | 457.13 g/mol |
| Exact Mass | 454.96 |
| IUPAC Name | 2-bromo-4-methoxyaniline;1-(2-bromo-4-methoxyphenyl)tetrazole |
| SMILES | COc1ccc(-n2cnnn2)c(Br)c1.COc1ccc(N)c(Br)c1 |
| InChI | InChI=1S/C8H7BrN4O.C7H8BrNO/c1-14-6-2-3-8(7(9)4-6)13-5-10-11-12-13;1-10-5-2-3-7(9)6(8)4-5/h2-5H,1H3;2-4H,9H2,1H3 |
| InChIKey | NEJTZVBCHYFZQO-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 457.13 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-4-methoxyaniline;1-(2-bromo-4-methoxyphenyl)tetrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-4-methoxyaniline;1-(2-bromo-4-methoxyphenyl)tetrazole?
The IUPAC name of 2-bromo-4-methoxyaniline;1-(2-bromo-4-methoxyphenyl)tetrazole (CID 159756962) is 2-bromo-4-methoxyaniline;1-(2-bromo-4-methoxyphenyl)tetrazole.
What is the SMILES notation for 2-bromo-4-methoxyaniline;1-(2-bromo-4-methoxyphenyl)tetrazole?
The canonical SMILES for 2-bromo-4-methoxyaniline;1-(2-bromo-4-methoxyphenyl)tetrazole is COc1ccc(-n2cnnn2)c(Br)c1.COc1ccc(N)c(Br)c1.
What is the InChIKey of 2-bromo-4-methoxyaniline;1-(2-bromo-4-methoxyphenyl)tetrazole?
The InChIKey is NEJTZVBCHYFZQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7BrN4O.C7H8BrNO/c1-14-6-2-3-8(7(9)4-6)13-5-10-11-12-13;1-10-5-2-3-7(9)6(8)4-5/h2-5H,1H3;2-4H,9H2,1H3.
What are the key properties of 2-bromo-4-methoxyaniline;1-(2-bromo-4-methoxyphenyl)tetrazole?
2-bromo-4-methoxyaniline;1-(2-bromo-4-methoxyphenyl)tetrazole has a molecular weight of 457.13 g/mol, XLogP of 3.47, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-4-methoxyaniline;1-(2-bromo-4-methoxyphenyl)tetrazole is sourced from PubChem (CID 159756962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).