C14H18N6O3 — CID 46983508
N'-[5-methoxy-2-(tetrazol-1-yl)phenyl]-N-(2-methylpropyl)oxamide (PubChem CID 46983508) has the molecular formula C14H18N6O3 and a molecular weight of 318.34 g/mol. Its IUPAC name is N'-[5-methoxy-2-(tetrazol-1-yl)phenyl]-N-(2-methylpropyl)oxamide.
| Compound Name | N'-[5-methoxy-2-(tetrazol-1-yl)phenyl]-N-(2-methylpropyl)oxamide |
|---|---|
| PubChem CID | 46983508 |
| Molecular Formula | C14H18N6O3 |
| Molecular Weight | 318.34 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | N'-[5-methoxy-2-(tetrazol-1-yl)phenyl]-N-(2-methylpropyl)oxamide |
| SMILES | COc1ccc(-n2cnnn2)c(NC(=O)C(=O)NCC(C)C)c1 |
| InChI | InChI=1S/C14H18N6O3/c1-9(2)7-15-13(21)14(22)17-11-6-10(23-3)4-5-12(11)20-8-16-18-19-20/h4-6,8-9H,7H2,1-3H3,(H,15,21)(H,17,22) |
| InChIKey | BEMUUPINRJRVCN-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 111.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.34 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|