C13H10ClN5O2S — CID 86858047
N-(2-chloro-4-methoxyphenyl)-3-(tetrazol-1-yl)thiophene-2-carboxamide (PubChem CID 86858047) has the molecular formula C13H10ClN5O2S and a molecular weight of 335.78 g/mol. Its IUPAC name is N-(2-chloro-4-methoxyphenyl)-3-(tetrazol-1-yl)thiophene-2-carboxamide.
| Compound Name | N-(2-chloro-4-methoxyphenyl)-3-(tetrazol-1-yl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 86858047 |
| Molecular Formula | C13H10ClN5O2S |
| Molecular Weight | 335.78 g/mol |
| Exact Mass | 335.02 |
| IUPAC Name | N-(2-chloro-4-methoxyphenyl)-3-(tetrazol-1-yl)thiophene-2-carboxamide |
| SMILES | COc1ccc(NC(=O)c2sccc2-n2cnnn2)c(Cl)c1 |
| InChI | InChI=1S/C13H10ClN5O2S/c1-21-8-2-3-10(9(14)6-8)16-13(20)12-11(4-5-22-12)19-7-15-17-18-19/h2-7H,1H3,(H,16,20) |
| InChIKey | OJYVWXVUFWPKMU-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.78 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |