C16H13ClN6O2S — CID 55805183
N-[3-chloro-4-(cyclopropylcarbamoyl)phenyl]-3-(tetrazol-1-yl)thiophene-2-carboxamide (PubChem CID 55805183) has the molecular formula C16H13ClN6O2S and a molecular weight of 388.84 g/mol. Its IUPAC name is N-[3-chloro-4-(cyclopropylcarbamoyl)phenyl]-3-(tetrazol-1-yl)thiophene-2-carboxamide.
| Compound Name | N-[3-chloro-4-(cyclopropylcarbamoyl)phenyl]-3-(tetrazol-1-yl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 55805183 |
| Molecular Formula | C16H13ClN6O2S |
| Molecular Weight | 388.84 g/mol |
| Exact Mass | 388.05 |
| IUPAC Name | N-[3-chloro-4-(cyclopropylcarbamoyl)phenyl]-3-(tetrazol-1-yl)thiophene-2-carboxamide |
| SMILES | O=C(NC1CC1)c1ccc(NC(=O)c2sccc2-n2cnnn2)cc1Cl |
| InChI | InChI=1S/C16H13ClN6O2S/c17-12-7-10(3-4-11(12)15(24)19-9-1-2-9)20-16(25)14-13(5-6-26-14)23-8-18-21-22-23/h3-9H,1-2H2,(H,19,24)(H,20,25) |
| InChIKey | ITPSWWJMKOJNOJ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.84 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |