C25H30N2O5 — CID 15975856
[(9R,10S,12S,13E,17R,18S)-18-acetyloxy-13-ethylidene-9-hydroxy-8-methyl-8,15-diazahexacyclo[14.2.1.01,9.02,7.010,15.012,17]nonadeca-2,4,6-trien-17-yl]methyl acetate (PubChem CID 15975856) has the molecular formula C25H30N2O5 and a molecular weight of 438.52 g/mol. Its IUPAC name is [(9R,10S,12S,13E,17R,18S)-18-acetyloxy-13-ethylidene-9-hydroxy-8-methyl-8,15-diazahexacyclo[14.2.1.01,9.02,7.010,15.012,17]nonadeca-2,4,6-trien-17-yl]methyl acetate.
| Compound Name | [(9R,10S,12S,13E,17R,18S)-18-acetyloxy-13-ethylidene-9-hydroxy-8-methyl-8,15-diazahexacyclo[14.2.1.01,9.02,7.010,15.012,17]nonadeca-2,4,6-trien-17-yl]methyl acetate |
|---|---|
| PubChem CID | 15975856 |
| Molecular Formula | C25H30N2O5 |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | [(9R,10S,12S,13E,17R,18S)-18-acetyloxy-13-ethylidene-9-hydroxy-8-methyl-8,15-diazahexacyclo[14.2.1.01,9.02,7.010,15.012,17]nonadeca-2,4,6-trien-17-yl]methyl acetate |
| SMILES | C/C=C1/CN2C3CC45c6ccccc6N(C)[C@]4(O)[C@@H]2C[C@@H]1[C@@]3(COC(C)=O)[C@@H]5OC(C)=O |
| InChI | InChI=1S/C25H30N2O5/c1-5-16-12-27-20-10-18(16)23(13-31-14(2)28)21(27)11-24(22(23)32-15(3)29)17-8-6-7-9-19(17)26(4)25(20,24)30/h5-9,18,20-22,30H,10-13H2,1-4H3/b16-5-/t18-,20-,21?,22-,23+,24?,25-/m0/s1 |
| InChIKey | DYXYGSRETPOTJA-HWRZLEGWSA-N |
| XLogP | 1.98 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|