C21H36O5S — CID 159760958
1-[3-(3-methoxy-3-methylbutoxy)-3-methylbutoxy]-3-(4-methoxyphenyl)sulfanylpropan-2-ol (PubChem CID 159760958) has the molecular formula C21H36O5S and a molecular weight of 400.58 g/mol. Its IUPAC name is 1-[3-(3-methoxy-3-methylbutoxy)-3-methylbutoxy]-3-(4-methoxyphenyl)sulfanylpropan-2-ol.
| Compound Name | 1-[3-(3-methoxy-3-methylbutoxy)-3-methylbutoxy]-3-(4-methoxyphenyl)sulfanylpropan-2-ol |
|---|---|
| PubChem CID | 159760958 |
| Molecular Formula | C21H36O5S |
| Molecular Weight | 400.58 g/mol |
| Exact Mass | 400.23 |
| IUPAC Name | 1-[3-(3-methoxy-3-methylbutoxy)-3-methylbutoxy]-3-(4-methoxyphenyl)sulfanylpropan-2-ol |
| SMILES | COc1ccc(SCC(O)COCCC(C)(C)OCCC(C)(C)OC)cc1 |
| InChI | InChI=1S/C21H36O5S/c1-20(2,24-6)12-14-26-21(3,4)11-13-25-15-17(22)16-27-19-9-7-18(23-5)8-10-19/h7-10,17,22H,11-16H2,1-6H3 |
| InChIKey | NEWICYVBFCVZKT-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.58 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|