C22H38O5S — CID 71243201
1-[3-(3-methoxy-3-methylbutoxy)-3-methylpentoxy]-3-(4-methoxyphenyl)sulfanylpropan-2-ol (PubChem CID 71243201) has the molecular formula C22H38O5S and a molecular weight of 414.61 g/mol. Its IUPAC name is 1-[3-(3-methoxy-3-methylbutoxy)-3-methylpentoxy]-3-(4-methoxyphenyl)sulfanylpropan-2-ol.
| Compound Name | 1-[3-(3-methoxy-3-methylbutoxy)-3-methylpentoxy]-3-(4-methoxyphenyl)sulfanylpropan-2-ol |
|---|---|
| PubChem CID | 71243201 |
| Molecular Formula | C22H38O5S |
| Molecular Weight | 414.61 g/mol |
| Exact Mass | 414.24 |
| IUPAC Name | 1-[3-(3-methoxy-3-methylbutoxy)-3-methylpentoxy]-3-(4-methoxyphenyl)sulfanylpropan-2-ol |
| SMILES | CCC(C)(CCOCC(O)CSc1ccc(OC)cc1)OCCC(C)(C)OC |
| InChI | InChI=1S/C22H38O5S/c1-7-22(4,27-15-12-21(2,3)25-6)13-14-26-16-18(23)17-28-20-10-8-19(24-5)9-11-20/h8-11,18,23H,7,12-17H2,1-6H3 |
| InChIKey | OCAAZIQZFCICNK-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.61 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|