C35H33FN2O3S2 — CID 159762466
5-[3-fluoro-4-[2-[3-(propylaminomethyl)phenyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]-1-(2-methoxyphenyl)-4-sulfanylidenepentan-2-one (PubChem CID 159762466) has the molecular formula C35H33FN2O3S2 and a molecular weight of 612.79 g/mol. Its IUPAC name is 5-[3-fluoro-4-[2-[3-(propylaminomethyl)phenyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]-1-(2-methoxyphenyl)-4-sulfanylidenepentan-2-one.
| Compound Name | 5-[3-fluoro-4-[2-[3-(propylaminomethyl)phenyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]-1-(2-methoxyphenyl)-4-sulfanylidenepentan-2-one |
|---|---|
| PubChem CID | 159762466 |
| Molecular Formula | C35H33FN2O3S2 |
| Molecular Weight | 612.79 g/mol |
| Exact Mass | 612.19 |
| IUPAC Name | 5-[3-fluoro-4-[2-[3-(propylaminomethyl)phenyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]-1-(2-methoxyphenyl)-4-sulfanylidenepentan-2-one |
| SMILES | CCCNCc1cccc(-c2cc3nccc(Oc4ccc(CC(=S)CC(=O)Cc5ccccc5OC)cc4F)c3s2)c1 |
| InChI | InChI=1S/C35H33FN2O3S2/c1-3-14-37-22-24-7-6-9-26(16-24)34-21-30-35(43-34)33(13-15-38-30)41-32-12-11-23(18-29(32)36)17-28(42)20-27(39)19-25-8-4-5-10-31(25)40-2/h4-13,15-16,18,21,37H,3,14,17,19-20,22H2,1-2H3 |
| InChIKey | NFBKHETVZMYRRN-UHFFFAOYSA-N |
| XLogP | 8.52 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.79 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|