C19H21N6O3S+ — CID 159763289
N-[(2-hydroxyisoquinolin-2-ium-8-yl)methyl]-2-methyl-8-propan-2-ylpyrazolo[1,5-a][1,3,5]triazin-4-amine;sulfur dioxide (PubChem CID 159763289) has the molecular formula C19H21N6O3S+ and a molecular weight of 413.48 g/mol. Its IUPAC name is N-[(2-hydroxyisoquinolin-2-ium-8-yl)methyl]-2-methyl-8-propan-2-ylpyrazolo[1,5-a][1,3,5]triazin-4-amine;sulfur dioxide.
| Compound Name | N-[(2-hydroxyisoquinolin-2-ium-8-yl)methyl]-2-methyl-8-propan-2-ylpyrazolo[1,5-a][1,3,5]triazin-4-amine;sulfur dioxide |
|---|---|
| PubChem CID | 159763289 |
| Molecular Formula | C19H21N6O3S+ |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | N-[(2-hydroxyisoquinolin-2-ium-8-yl)methyl]-2-methyl-8-propan-2-ylpyrazolo[1,5-a][1,3,5]triazin-4-amine;sulfur dioxide |
| SMILES | Cc1nc(NCc2cccc3cc[n+](O)cc23)n2ncc(C(C)C)c2n1.O=S=O |
| InChI | InChI=1S/C19H21N6O.O2S/c1-12(2)16-10-21-25-18(16)22-13(3)23-19(25)20-9-15-6-4-5-14-7-8-24(26)11-17(14)15;1-3-2/h4-8,10-12,26H,9H2,1-3H3,(H,20,22,23);/q+1; |
| InChIKey | NFEFMDAXNTYPBU-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 113.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|