C21H21FN2O4S — CID 159765275
3-fluoro-5-[[1-(3-methoxypropylamino)-7-methylsulfonyl-3H-inden-4-yl]oxy]benzonitrile (PubChem CID 159765275) has the molecular formula C21H21FN2O4S and a molecular weight of 416.47 g/mol. Its IUPAC name is 3-fluoro-5-[[1-(3-methoxypropylamino)-7-methylsulfonyl-3H-inden-4-yl]oxy]benzonitrile.
| Compound Name | 3-fluoro-5-[[1-(3-methoxypropylamino)-7-methylsulfonyl-3H-inden-4-yl]oxy]benzonitrile |
|---|---|
| PubChem CID | 159765275 |
| Molecular Formula | C21H21FN2O4S |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | 3-fluoro-5-[[1-(3-methoxypropylamino)-7-methylsulfonyl-3H-inden-4-yl]oxy]benzonitrile |
| SMILES | COCCCNC1=CCc2c(Oc3cc(F)cc(C#N)c3)ccc(S(C)(=O)=O)c21 |
| InChI | InChI=1S/C21H21FN2O4S/c1-27-9-3-8-24-18-5-4-17-19(6-7-20(21(17)18)29(2,25)26)28-16-11-14(13-23)10-15(22)12-16/h5-7,10-12,24H,3-4,8-9H2,1-2H3 |
| InChIKey | DBRVOULZPKDBLD-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|