C19H13F4NO5S — CID 123401438
methyl 3-[3-(3-cyano-5-fluorophenoxy)-2-methyl-6-(trifluoromethylsulfonyl)phenyl]prop-2-enoate (PubChem CID 123401438) has the molecular formula C19H13F4NO5S and a molecular weight of 443.37 g/mol. Its IUPAC name is methyl 3-[3-(3-cyano-5-fluorophenoxy)-2-methyl-6-(trifluoromethylsulfonyl)phenyl]prop-2-enoate.
| Compound Name | methyl 3-[3-(3-cyano-5-fluorophenoxy)-2-methyl-6-(trifluoromethylsulfonyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 123401438 |
| Molecular Formula | C19H13F4NO5S |
| Molecular Weight | 443.37 g/mol |
| Exact Mass | 443.05 |
| IUPAC Name | methyl 3-[3-(3-cyano-5-fluorophenoxy)-2-methyl-6-(trifluoromethylsulfonyl)phenyl]prop-2-enoate |
| SMILES | COC(=O)C=Cc1c(S(=O)(=O)C(F)(F)F)ccc(Oc2cc(F)cc(C#N)c2)c1C |
| InChI | InChI=1S/C19H13F4NO5S/c1-11-15(3-6-18(25)28-2)17(30(26,27)19(21,22)23)5-4-16(11)29-14-8-12(10-24)7-13(20)9-14/h3-9H,1-2H3 |
| InChIKey | PQLIJTATPNVDOH-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 93.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.37 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|