C19H14F4N2O4S — CID 122506197
(E)-3-[3-(3-cyano-5-fluorophenoxy)-2-methyl-6-(trifluoromethylsulfonyl)phenyl]-N-methylprop-2-enamide (PubChem CID 122506197) has the molecular formula C19H14F4N2O4S and a molecular weight of 442.39 g/mol. Its IUPAC name is (E)-3-[3-(3-cyano-5-fluorophenoxy)-2-methyl-6-(trifluoromethylsulfonyl)phenyl]-N-methylprop-2-enamide.
| Compound Name | (E)-3-[3-(3-cyano-5-fluorophenoxy)-2-methyl-6-(trifluoromethylsulfonyl)phenyl]-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 122506197 |
| Molecular Formula | C19H14F4N2O4S |
| Molecular Weight | 442.39 g/mol |
| Exact Mass | 442.06 |
| IUPAC Name | (E)-3-[3-(3-cyano-5-fluorophenoxy)-2-methyl-6-(trifluoromethylsulfonyl)phenyl]-N-methylprop-2-enamide |
| SMILES | CNC(=O)/C=C/c1c(S(=O)(=O)C(F)(F)F)ccc(Oc2cc(F)cc(C#N)c2)c1C |
| InChI | InChI=1S/C19H14F4N2O4S/c1-11-15(3-6-18(26)25-2)17(30(27,28)19(21,22)23)5-4-16(11)29-14-8-12(10-24)7-13(20)9-14/h3-9H,1-2H3,(H,25,26)/b6-3+ |
| InChIKey | GNDHKPCXBBMYNV-ZZXKWVIFSA-N |
| XLogP | 3.85 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.39 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|