C19H13F4NO5S — CID 151689812
(E)-3-[3-[3-(cyanomethyl)-5-fluorophenoxy]-2-methyl-6-(trifluoromethylsulfonyl)phenyl]prop-2-enoic acid (PubChem CID 151689812) has the molecular formula C19H13F4NO5S and a molecular weight of 443.37 g/mol. Its IUPAC name is (E)-3-[3-[3-(cyanomethyl)-5-fluorophenoxy]-2-methyl-6-(trifluoromethylsulfonyl)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-[3-(cyanomethyl)-5-fluorophenoxy]-2-methyl-6-(trifluoromethylsulfonyl)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 151689812 |
| Molecular Formula | C19H13F4NO5S |
| Molecular Weight | 443.37 g/mol |
| Exact Mass | 443.05 |
| IUPAC Name | (E)-3-[3-[3-(cyanomethyl)-5-fluorophenoxy]-2-methyl-6-(trifluoromethylsulfonyl)phenyl]prop-2-enoic acid |
| SMILES | Cc1c(Oc2cc(F)cc(CC#N)c2)ccc(S(=O)(=O)C(F)(F)F)c1/C=C/C(=O)O |
| InChI | InChI=1S/C19H13F4NO5S/c1-11-15(2-5-18(25)26)17(30(27,28)19(21,22)23)4-3-16(11)29-14-9-12(6-7-24)8-13(20)10-14/h2-5,8-10H,6H2,1H3,(H,25,26)/b5-2+ |
| InChIKey | RCHZZPIYFCVSKG-GORDUTHDSA-N |
| XLogP | 4.38 |
| TPSA | 104.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.37 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|