C16H9F4NO2S — CID 138638131
3-fluoro-5-[3-formyl-2-methyl-4-(trifluoromethylsulfanyl)phenoxy]benzonitrile (PubChem CID 138638131) has the molecular formula C16H9F4NO2S and a molecular weight of 355.31 g/mol. Its IUPAC name is 3-fluoro-5-[3-formyl-2-methyl-4-(trifluoromethylsulfanyl)phenoxy]benzonitrile.
| Compound Name | 3-fluoro-5-[3-formyl-2-methyl-4-(trifluoromethylsulfanyl)phenoxy]benzonitrile |
|---|---|
| PubChem CID | 138638131 |
| Molecular Formula | C16H9F4NO2S |
| Molecular Weight | 355.31 g/mol |
| Exact Mass | 355.03 |
| IUPAC Name | 3-fluoro-5-[3-formyl-2-methyl-4-(trifluoromethylsulfanyl)phenoxy]benzonitrile |
| SMILES | Cc1c(Oc2cc(F)cc(C#N)c2)ccc(SC(F)(F)F)c1C=O |
| InChI | InChI=1S/C16H9F4NO2S/c1-9-13(8-22)15(24-16(18,19)20)3-2-14(9)23-12-5-10(7-21)4-11(17)6-12/h2-6,8H,1H3 |
| InChIKey | HAFRXSZHIIYLTN-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.31 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|