C10H15F3O3 — CID 159771224
2-methylprop-1-ene;2-(oxiran-2-yloxy)-3-(2,2,2-trifluoroethyl)oxirane (PubChem CID 159771224) has the molecular formula C10H15F3O3 and a molecular weight of 240.22 g/mol. Its IUPAC name is 2-methylprop-1-ene;2-(oxiran-2-yloxy)-3-(2,2,2-trifluoroethyl)oxirane.
| Compound Name | 2-methylprop-1-ene;2-(oxiran-2-yloxy)-3-(2,2,2-trifluoroethyl)oxirane |
|---|---|
| PubChem CID | 159771224 |
| Molecular Formula | C10H15F3O3 |
| Molecular Weight | 240.22 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | 2-methylprop-1-ene;2-(oxiran-2-yloxy)-3-(2,2,2-trifluoroethyl)oxirane |
| SMILES | C=C(C)C.FC(F)(F)CC1OC1OC1CO1 |
| InChI | InChI=1S/C6H7F3O3.C4H8/c7-6(8,9)1-3-5(11-3)12-4-2-10-4;1-4(2)3/h3-5H,1-2H2;1H2,2-3H3 |
| InChIKey | NGDFWSJQYMCGHE-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 34.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.22 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|