C16H13Br2NO2 — CID 159771681
N,4-bis(3-bromophenyl)-3-oxobutanamide (PubChem CID 159771681) has the molecular formula C16H13Br2NO2 and a molecular weight of 411.09 g/mol. Its IUPAC name is N,4-bis(3-bromophenyl)-3-oxobutanamide.
| Compound Name | N,4-bis(3-bromophenyl)-3-oxobutanamide |
|---|---|
| PubChem CID | 159771681 |
| Molecular Formula | C16H13Br2NO2 |
| Molecular Weight | 411.09 g/mol |
| Exact Mass | 408.93 |
| IUPAC Name | N,4-bis(3-bromophenyl)-3-oxobutanamide |
| SMILES | O=C(CC(=O)Nc1cccc(Br)c1)Cc1cccc(Br)c1 |
| InChI | InChI=1S/C16H13Br2NO2/c17-12-4-1-3-11(7-12)8-15(20)10-16(21)19-14-6-2-5-13(18)9-14/h1-7,9H,8,10H2,(H,19,21) |
| InChIKey | GQLAXIAAJXXYEN-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.09 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|