C27H33N3O4S — CID 159774959
4-methyl-N-[6-methyl-1-[4-(propan-2-ylcarbamoyl)cyclohexyl]-3H-indol-2-ylidene]benzamide;sulfur dioxide (PubChem CID 159774959) has the molecular formula C27H33N3O4S and a molecular weight of 495.65 g/mol. Its IUPAC name is 4-methyl-N-[6-methyl-1-[4-(propan-2-ylcarbamoyl)cyclohexyl]-3H-indol-2-ylidene]benzamide;sulfur dioxide.
| Compound Name | 4-methyl-N-[6-methyl-1-[4-(propan-2-ylcarbamoyl)cyclohexyl]-3H-indol-2-ylidene]benzamide;sulfur dioxide |
|---|---|
| PubChem CID | 159774959 |
| Molecular Formula | C27H33N3O4S |
| Molecular Weight | 495.65 g/mol |
| Exact Mass | 495.22 |
| IUPAC Name | 4-methyl-N-[6-methyl-1-[4-(propan-2-ylcarbamoyl)cyclohexyl]-3H-indol-2-ylidene]benzamide;sulfur dioxide |
| SMILES | Cc1ccc(C(=O)/N=C2\Cc3ccc(C)cc3N2C2CCC(C(=O)NC(C)C)CC2)cc1.O=S=O |
| InChI | InChI=1S/C27H33N3O2.O2S/c1-17(2)28-26(31)21-11-13-23(14-12-21)30-24-15-19(4)7-10-22(24)16-25(30)29-27(32)20-8-5-18(3)6-9-20;1-3-2/h5-10,15,17,21,23H,11-14,16H2,1-4H3,(H,28,31);/b29-25+; |
| InChIKey | NGPQIUALFPHWII-DPWCPDSHSA-N |
| XLogP | 4.32 |
| TPSA | 95.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.65 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|