C27H33FN4O4 — CID 159891757
4-fluoro-N-[6-(2-methoxyethoxy)-1-[4-(propan-2-ylcarbamoyl)cyclohexyl]-3H-pyrrolo[3,2-c]pyridin-2-ylidene]benzamide (PubChem CID 159891757) has the molecular formula C27H33FN4O4 and a molecular weight of 496.58 g/mol. Its IUPAC name is 4-fluoro-N-[6-(2-methoxyethoxy)-1-[4-(propan-2-ylcarbamoyl)cyclohexyl]-3H-pyrrolo[3,2-c]pyridin-2-ylidene]benzamide.
| Compound Name | 4-fluoro-N-[6-(2-methoxyethoxy)-1-[4-(propan-2-ylcarbamoyl)cyclohexyl]-3H-pyrrolo[3,2-c]pyridin-2-ylidene]benzamide |
|---|---|
| PubChem CID | 159891757 |
| Molecular Formula | C27H33FN4O4 |
| Molecular Weight | 496.58 g/mol |
| Exact Mass | 496.25 |
| IUPAC Name | 4-fluoro-N-[6-(2-methoxyethoxy)-1-[4-(propan-2-ylcarbamoyl)cyclohexyl]-3H-pyrrolo[3,2-c]pyridin-2-ylidene]benzamide |
| SMILES | COCCOc1cc2c(cn1)C/C(=N\C(=O)c1ccc(F)cc1)N2C1CCC(C(=O)NC(C)C)CC1 |
| InChI | InChI=1S/C27H33FN4O4/c1-17(2)30-26(33)19-6-10-22(11-7-19)32-23-15-25(36-13-12-35-3)29-16-20(23)14-24(32)31-27(34)18-4-8-21(28)9-5-18/h4-5,8-9,15-17,19,22H,6-7,10-14H2,1-3H3,(H,30,33)/b31-24+ |
| InChIKey | NUVMORAKBAYSLH-QFMPWRQOSA-N |
| XLogP | 3.93 |
| TPSA | 93.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.58 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|